| Compound Information | |
|---|---|
| ID | 456 |
| TrivialName | 20(S)-ginsenoside Rf2 |
| Type | C17-side chain varied |
| MF | C₄₂H₇₄O₁₄ |
| MolecularWeight | 803.040000000001 |
| IUPACName | NT |
| m/z | NT |
| Retention Time | NT |
| CCS | NT |
| Adducts | NT |
| Isomeric SMILES | CC1(C)[C@@H](O)CC[C@@]2(C)C1[C@@H](O[C@H]3[C@H](O[C@H]4[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O4)[C@@H](O)[C@H](O)[C@@H](CO)O3)C[C@]5(C)C2C[C@@H](O)C6[C@@]5(C)CCC6[C@@](CCCC(C)(O)C)(C)O |
| Canonical SMILES | CC1OC(OC2C(OC3CC4(C)C(CC(O)C5C(C(C)(O)CCCC(C)(C)O)CCC54C)C4(C)CCC(O)C(C)(C)C34)OC(CO)C(O)C2O)C(O)C(O)C1O |
| Source | PG |
| Functions | Increase the utilisation of ginseng in agricultural products, food, dietary supplements, nutraceuticals and pharmaceuticals, and also facilitate the future development of new high-functional ginseng products by combining various processing methods. |
| Year | 2015 |
| References | |
| Structure |
|