| Compound Information | |
|---|---|
| ID | 725 |
| TrivialName | Protocatechuic acid |
| Type | Miscellaneous |
| MF | C₇H₆O₄ |
| MolecularWeight | 154.121 |
| IUPACName | 3,4-dihydroxybenzoic acid |
| m/z | NT |
| Retention Time | NT |
| CCS | NT |
| Adducts | NT |
| Isomeric SMILES | [H]OC(C1=CC=C(O[H])C(O[H])=C1)=O |
| Canonical SMILES | O=C(O)c1ccc(O)c(O)c1 |
| Source | PG |
| Functions | antioxidant, anti-inflammation, liver protection, increase proliferation and inhibit apoptosis of neural stem cells |
| Toxicity Organism | mouse |
| Toxicity Type | LD50 |
| Toxicity Route | intraperitoneal |
| Toxicity Dose | >800 mg/kg |
| Year | 2021 |
| References | |
| Structure |
|